CAS 849797-79-1

2-benzylimidazo[3,4-a]quinolin-2-ium hexafluorophosphate

Description:

2-benzylimidazo[3,4-a]quinolin-2-ium hexafluorophosphate is a chemical compound characterized by its unique structure, which combines an imidazoquinoline framework with a benzyl group. This compound features a positively charged imidazoquinoline moiety, making it a type of ionic liquid when paired with the hexafluorophosphate anion, which is known for its stability and low volatility. The hexafluorophosphate (PF6) counterion contributes to the compound's solubility in polar solvents and enhances its ionic character. This substance is often utilized in organic synthesis and as a catalyst in various chemical reactions due to its ability to stabilize reactive intermediates. Additionally, its unique electronic properties may make it suitable for applications in materials science and electrochemistry. The presence of the benzyl group can also influence its reactivity and interaction with other molecules, making it a subject of interest in medicinal chemistry and drug design. Overall, this compound exemplifies the intersection of organic chemistry and materials science, showcasing the versatility of imidazoquinoline derivatives.

Formula: C₁₈H₁₅F₆N₂P

InChI: InChI=1/C18H15N2.F6P/c1-2-6-15(7-3-1)12-19-13-17-11-10-16-8-4-5-9-18(16)20(17)14-19;1-7(2,3,4,5)6/h1-11,13-14H,12H2;/q+1;-1