CAS 849805-26-1

Methyl 2-amino-6-(methoxymethyl)-3-pyridinecarboxylate

Description:

Methyl 2-amino-6-(methoxymethyl)-3-pyridinecarboxylate, identified by its CAS number 849805-26-1, is a chemical compound that features a pyridine ring substituted with an amino group and a methoxymethyl group. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural motifs that may interact with biological targets. The presence of the amino group suggests basic properties, while the carboxylate moiety can participate in various chemical reactions, including esterification and amidation. The methoxymethyl group enhances the compound's lipophilicity, which can influence its bioavailability and pharmacokinetics. Additionally, the compound's molecular structure may exhibit specific stereochemistry, affecting its reactivity and interaction with enzymes or receptors. Overall, Methyl 2-amino-6-(methoxymethyl)-3-pyridinecarboxylate is a versatile compound with significant implications in chemical synthesis and drug design.

Formula: C₉H₁₂N₂O₃

InChI: InChI=1S/C9H12N2O3/c1-13-5-6-3-4-7(8(10)11-6)9(12)14-2/h3-4H,5H2,1-2H3,(H2,10,11)

InChI key: InChIKey=DDKQJIIOOPBFCO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(N)N=C(COC)C=C1

Synonyms:

• 3-Pyridinecarboxylic acid, 2-amino-6-(methoxymethyl)-, methyl ester
• Methyl 2-amino-6-(methoxymethyl)-3-pyridinecarboxylate
• 2-Amino-6-(methoxymethyl)nicotinic acid methyl ester