CAS 849805-64-7

Ethyl 4-chloro-6-cinnolinecarboxylate

Description:

Ethyl 4-chloro-6-cinnolinecarboxylate is an organic compound characterized by its unique structure, which includes a cinnoline ring system and an ethyl ester functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of the chloro substituent can influence its reactivity and interaction with biological targets. Ethyl 4-chloro-6-cinnolinecarboxylate is generally soluble in organic solvents, which makes it suitable for various synthetic processes. Its synthesis often involves multi-step reactions, including the formation of the cinnoline ring and subsequent esterification. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, this compound represents a valuable entity in the field of organic synthesis and drug discovery.

Formula: C₁₁H₉ClN₂O₂

InChI: InChI=1S/C11H9ClN2O2/c1-2-16-11(15)7-3-4-10-8(5-7)9(12)6-13-14-10/h3-6H,2H2,1H3

InChI key: InChIKey=OYVKMDHELZOSHC-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=CC(C(OCC)=O)=C2)N=NC1

Synonyms:

• Ethyl 4-chloro-6-cinnolinecarboxylate
• 6-Cinnolinecarboxylic acid, 4-chloro-, ethyl ester