CAS 849805-79-4
:2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid
Description:
2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its bicyclic structure, which includes a pyrrolidine and a pyridine ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The carboxylic acid moiety contributes to its acidity and can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry, particularly for its potential biological activities, including effects on neurotransmitter systems or as a scaffold for drug development. Its unique structural features may also allow for specific interactions with biological targets, making it a candidate for further research in pharmacology. As with many heterocycles, the stability and reactivity can be influenced by substituents on the rings, which can modify its chemical behavior and potential applications.
Formula:C8H8N2O2
InChI:InChI=1S/C8H8N2O2/c11-8(12)6-3-5-1-2-9-7(5)10-4-6/h3-4H,1-2H2,(H,9,10)(H,11,12)
InChI key:InChIKey=AZURZTXEHXPEED-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(=NC1)NCC2
Synonyms:- 1H,2H,3H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid
- 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 2,3-dihydro-
- 2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid
- 3,7-Dihydro-2H-pyrrolo[2,3-b]pyridine-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.