CAS 849807-02-9
:4-[(4-Fluorophenyl)methoxy]benzenemethanamine
Description:
4-[(4-Fluorophenyl)methoxy]benzenemethanamine, identified by its CAS number 849807-02-9, is an organic compound characterized by its complex structure, which includes a methanamine group attached to a benzene ring that is further substituted with a methoxy group and a fluorophenyl moiety. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. Such compounds may be of interest in medicinal chemistry for their potential pharmacological applications, including roles as intermediates in the synthesis of pharmaceuticals or as active pharmaceutical ingredients. Additionally, the presence of both electron-donating (methoxy) and electron-withdrawing (fluoro) groups can lead to interesting reactivity patterns and interactions in biological systems.
Formula:C14H14FNO
InChI:InChI=1S/C14H14FNO/c15-13-5-1-12(2-6-13)10-17-14-7-3-11(9-16)4-8-14/h1-8H,9-10,16H2
InChI key:InChIKey=UAZWSEVTDFFCDM-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(F)C=C1)C2=CC=C(CN)C=C2
Synonyms:- [4-[(4-Fluorophenyl)methoxy]phenyl]methanamine
- 4-[(4-Fluorophenyl)methoxy]benzenemethanamine
- Benzenemethanamine, 4-[(4-fluorophenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.