CAS 849833-60-9

[C(Z)]-N-Hydroxy-2-pyridinecarboximidamide

Description:

[C(Z)]-N-Hydroxy-2-pyridinecarboximidamide, with the CAS number 849833-60-9, is a chemical compound characterized by its unique structural features, including a pyridine ring and a hydroxylamine functional group. This compound typically exhibits properties associated with both amides and hydroxylamines, which may include moderate solubility in polar solvents and potential reactivity towards electrophiles due to the presence of the hydroxylamine moiety. The pyridine ring contributes to its aromatic stability and may influence its electronic properties, making it a candidate for various chemical reactions, including those involving nucleophilic attack. Additionally, the compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry. Its specific applications and interactions would depend on the context of its use, including potential roles in drug development or as a reagent in synthetic organic chemistry. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₆H₇N₃O

InChI: InChI=1S/C6H7N3O/c7-6(9-10)5-3-1-2-4-8-5/h1-4,10H,(H2,7,9)

InChI key: InChIKey=XKXCGXSHUNVFCT-UHFFFAOYSA-N

SMILES: C(=N\O)(\N)/C1=CC=CC=N1

Synonyms:

• [C(Z)]-N-Hydroxy-2-pyridinecarboximidamide
• (Z)-N′-Hydroxypicolinimidamide
• 2-Pyridinecarboximidamide, N-hydroxy-, [C(Z)]-