
CAS 84988-62-5
:3,6,9,12-Tetraoxahexadecan-1-ol, phosphate
Description:
3,6,9,12-Tetraoxahexadecan-1-ol, phosphate, also known by its CAS number 84988-62-5, is a chemical compound characterized by its unique structure that includes a long hydrocarbon chain with multiple ether linkages and a phosphate group. This compound is part of a class of molecules known as phospholipids, which are essential in biological membranes. The presence of the tetraoxa (four ether oxygen atoms) contributes to its hydrophilicity, making it amphiphilic, meaning it has both hydrophilic (water-attracting) and hydrophobic (water-repelling) properties. This characteristic is crucial for its role in forming lipid bilayers in cellular membranes. Additionally, the phosphate group can participate in various biochemical interactions, influencing the compound's solubility and reactivity. Its applications may extend to areas such as drug delivery systems, surfactants, and emulsifiers in various industrial processes. Overall, the structural features of 3,6,9,12-Tetraoxahexadecan-1-ol, phosphate make it a significant compound in both chemistry and biochemistry.
Formula:C12H26O5·xH3O4P
InChI:InChI=1S/C12H26O5.H3O4P/c1-2-3-5-14-7-9-16-11-12-17-10-8-15-6-4-13;1-5(2,3)4/h13H,2-12H2,1H3;(H3,1,2,3,4)
InChI key:InChIKey=DKDKRXNOPUVYEJ-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)O.C(COCCOCCO)OCCOCCCC
Synonyms:- 3,6,9,12-Tetraoxahexadecan-1-ol, phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
