CAS 849924-75-0
:(3R)-3-Propoxypyrrolidine
Description:
(3R)-3-Propoxypyrrolidine is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle. The "3R" designation indicates the specific stereochemistry at the third carbon atom of the ring, which is crucial for its biological activity and interactions. The propoxy group attached to the nitrogen atom enhances its solubility and reactivity, making it of interest in medicinal chemistry and drug development. This compound may exhibit properties such as being a potential ligand or substrate in various chemical reactions, and its chirality can influence its pharmacokinetics and pharmacodynamics. The presence of the nitrogen atom in the ring contributes to its basicity, allowing it to participate in hydrogen bonding and other interactions in biological systems. Overall, (3R)-3-Propoxypyrrolidine's unique structural features make it a valuable compound for research in organic synthesis and pharmaceutical applications.
Formula:C7H15NO
InChI:InChI=1S/C7H15NO/c1-2-5-9-7-3-4-8-6-7/h7-8H,2-6H2,1H3/t7-/m1/s1
InChI key:InChIKey=JWNBCQQQLMTPLP-SSDOTTSWSA-N
SMILES:O(CCC)[C@@H]1CCNC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
