CymitQuimica logo

CAS 849925-01-5

:

Pyridine,3-[5-(4-piperidinyl)-1,2,4-oxadiazol-3-yl]-

Description:
Pyridine, 3-[5-(4-piperidinyl)-1,2,4-oxadiazol-3-yl]- is a chemical compound characterized by its heterocyclic structure, which includes a pyridine ring and an oxadiazole moiety. The presence of the piperidine group contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in polar solvents and may display basicity due to the nitrogen atoms in its structure. The oxadiazole ring is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory effects. The compound's molecular structure suggests potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, its unique combination of functional groups may influence its reactivity and stability, making it a subject of interest in synthetic organic chemistry and drug development. As with many heterocyclic compounds, the specific characteristics, including melting point, boiling point, and spectral properties, would need to be determined experimentally for precise applications.
Formula:C12H14N4O
InChI:InChI=1S/C12H14N4O/c1-2-10(8-14-5-1)11-15-12(17-16-11)9-3-6-13-7-4-9/h1-2,5,8-9,13H,3-4,6-7H2
InChI key:DYVVZZYZACPGHP-UHFFFAOYSA-N
SMILES:C1CNCCC1C2=NC(=NO2)C3=CN=CC=C3
Found 4 products.