CAS 849925-21-9
:1,2,3,4,5-cyclopentanepentayl, compd. with 1-[(1R)-1-[bis(3,5-dimethylphenyl)phosphino]ethyl]-2-[2-(diphenylphosphino)phenyl]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
Description:
The compound you referenced, with the CAS number 849925-21-9, is a complex organometallic substance that features a cyclopentane framework and is coordinated with iron. It contains multiple phosphine ligands, specifically bis(3,5-dimethylphenyl)phosphino and diphenylphosphino groups, which enhance its reactivity and stability. The presence of these bulky phosphine ligands typically contributes to the compound's ability to participate in various catalytic processes, particularly in organic synthesis and polymerization reactions. The iron center in this compound likely plays a crucial role in mediating electron transfer and facilitating chemical transformations. Additionally, the structural arrangement suggests potential chirality due to the presence of asymmetric centers, which may influence its reactivity and interaction with other molecules. Overall, this compound exemplifies the intricate design of organometallic complexes for specific applications in catalysis and materials science.
Formula:C46H44FeP2
InChI:InChI=1/C41H39P2.C5H5.Fe/c1-29-23-30(2)26-36(25-29)42(37-27-31(3)24-32(4)28-37)33(5)38-20-14-21-39(38)40-19-12-13-22-41(40)43(34-15-8-6-9-16-34)35-17-10-7-11-18-35;1-2-4-5-3-1;/h6-28,33H,1-5H3;1-5H;/t33-;;/m1../s1
SMILES:Cc1cc(C)cc(c1)P([C@H](C)C1C=CC=C1c1ccccc1P(c1ccccc1)c1ccccc1)c1cc(C)cc(C)c1.C1=C[CH]C=C1.[Fe]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(S)-1-{(SP)-2-[2-(Diphenylphosphino)phenyl]ferrocenyl}ethyldi(3,5-xylyl)phosphine
CAS:Formula:C46H44FeP2Molecular weight:714.6341

