CAS 849928-27-4

1,1-Dimethylethyl 4-cyano-4-(dimethylamino)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-cyano-4-(dimethylamino)-1-piperidinecarboxylate, with CAS number 849928-27-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a cyano group, and a dimethylamino substituent. This compound typically exhibits properties associated with both basic and acidic functionalities due to the presence of the piperidine nitrogen and the carboxylate group. It is often used in organic synthesis and medicinal chemistry, potentially serving as an intermediate in the development of pharmaceuticals. The presence of the cyano group suggests that it may participate in nucleophilic reactions, while the dimethylamino group can influence its solubility and reactivity. Additionally, the tert-butyl group contributes to steric hindrance, which can affect the compound's interaction with biological targets. Overall, this compound's unique structural features make it a subject of interest in various chemical research applications, particularly in the fields of drug discovery and development.

Formula: C₁₃H₂₃N₃O₂

InChI: InChI=1S/C13H23N3O2/c1-12(2,3)18-11(17)16-8-6-13(10-14,7-9-16)15(4)5/h6-9H2,1-5H3

InChI key: InChIKey=COVRYKGBHLVHIR-UHFFFAOYSA-N

SMILES: N(C)(C)C1(C#N)CCN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-cyano-4-(dimethylamino)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-cyano-4-(dimethylamino)-1-piperidinecarboxylate