CAS 849928-39-8

Benzenemethanol, α-(aminomethyl)-3-fluoro-, hydrochloride (1:1)

Description:

Benzenemethanol, α-(aminomethyl)-3-fluoro-, hydrochloride (1:1), with the CAS number 849928-39-8, is a chemical compound characterized by its structure, which includes a benzene ring substituted with a hydroxymethyl group and an amino group that is further substituted with a fluorine atom at the meta position. This compound exists as a hydrochloride salt, indicating that it is typically encountered in its protonated form, which enhances its solubility in water. The presence of the amino group suggests potential basicity, while the hydroxymethyl group can participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. The fluorine atom may impart unique electronic properties, affecting the compound's overall stability and reactivity. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the benzene ring can significantly alter biological activity. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₁₀FNO·ClH

InChI: InChI=1S/C8H10FNO.ClH/c9-7-3-1-2-6(4-7)8(11)5-10;/h1-4,8,11H,5,10H2;1H

InChI key: InChIKey=WKSRRMYMQDUSBG-UHFFFAOYSA-N

SMILES: C(CN)(O)C1=CC(F)=CC=C1.Cl

Synonyms:

• Benzenemethanol, α-(aminomethyl)-3-fluoro-, hydrochloride
• Benzenemethanol, α-(aminomethyl)-3-fluoro-, hydrochloride (1:1)