CAS 849937-90-2

2,4-Difluoro-3-pyridinecarboxylic acid

Description:

2,4-Difluoro-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two fluorine atoms at the 2 and 4 positions of the pyridine ring significantly influences its chemical properties, including increased electronegativity and potential reactivity. The carboxylic acid functional group at the 3-position contributes to its acidity and ability to participate in hydrogen bonding, making it soluble in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure allows for various synthetic applications, particularly in the creation of more complex molecules. Additionally, the presence of fluorine can enhance lipophilicity and metabolic stability, which are valuable traits in drug design. Overall, 2,4-Difluoro-3-pyridinecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and agrochemicals.

Formula: C₆H₃F₂NO₂

InChI: InChI=1S/C6H3F2NO2/c7-3-1-2-9-5(8)4(3)6(10)11/h1-2H,(H,10,11)

InChI key: InChIKey=AXAJZJNPIWNZAE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(F)=CC=NC1F

Synonyms:

• 3-Pyridinecarboxylic acid, 2,4-difluoro-
• 2,4-Difluoronicotinic acid
• 2,4-Difluoropyridine-3-carboxylic acid
• 2,4-Difluoro-nicotinic acid
• 2,4-Difluoro-3-pyridinecarboxylic acid

2,4-Difluoronicotinic acid

CAS: 849937-90-2

Formula: C₆H₃F₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 159.0903

Ref: IN-DA00G9R2

2,4-Difluoronicotinic acid

CAS: 849937-90-2

2,4-Difluoronicotinic acid

Purity: ≥95%

Molecular weight: 159.09g/mol

Ref: 54-PC502294

2,4-difluoronicotinic acid

CAS: 849937-90-2

Versatile small molecule scaffold

Formula: C₆H₃F₂NO₂

Purity: Min. 95%

Molecular weight: 159.09 g/mol

Ref: 3D-ZIB93790