CAS 849937-91-3

4,6-difluoropyridine-3-carboxylic acid

Description:

4,6-Difluoropyridine-3-carboxylic acid is an aromatic heterocyclic compound characterized by a pyridine ring substituted with two fluorine atoms at the 4 and 6 positions and a carboxylic acid group at the 3 position. This compound typically exhibits a polar nature due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The fluorine substituents contribute to its unique electronic properties, potentially influencing its reactivity and interactions in various chemical environments. As a pyridine derivative, it may participate in nucleophilic substitution reactions and serve as a building block in the synthesis of pharmaceuticals and agrochemicals. The compound's molecular structure allows for potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. Additionally, its stability and reactivity can be influenced by the presence of the fluorine atoms, which can affect the compound's overall chemical behavior and interactions with other substances.

Formula: C₆H₃F₂NO₂

InChI: InChI=1/C6H3F2NO2/c7-4-1-5(8)9-2-3(4)6(10)11/h1-2H,(H,10,11)

SMILES: c1c(c(cnc1F)C(=O)O)F

Synonyms:

• 3-Pyridinecarboxylic Acid, 4,6-Difluoro-
• 4,6-Difluoronicotinic acid
• 4,6-Difluoro-nicotinic acid
• 4,6-Difluoropyridine-3-carboxylic acid

4,6-Difluoronicotinic acid

CAS: 849937-91-3

Formula: C₆H₃F₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 159.0903

Ref: IN-DA0038EH

4,6-Difluoronicotinic acid

CAS: 849937-91-3

4,6-Difluoronicotinic acid

Purity: 98%

Molecular weight: 159.09g/mol

Ref: 54-PC111327

4,6-Difluoronicotinic acid

CAS: 849937-91-3

Formula: C₆H₃F₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 159.092

Ref: 10-F233158