CymitQuimica logo

CAS 849937-93-5

:

4-Bromo-2,3,6-trifluoropyridine

Description:
4-Bromo-2,3,6-trifluoropyridine is a heterocyclic aromatic compound characterized by the presence of a pyridine ring substituted with bromine and three fluorine atoms. The molecular structure features a bromine atom at the 4-position and trifluoromethyl groups at the 2, 3, and 6 positions, which significantly influence its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits high thermal stability and is relatively non-polar due to the electronegative fluorine atoms, which can enhance its reactivity in nucleophilic substitution reactions. The presence of the bromine atom also contributes to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 4-Bromo-2,3,6-trifluoropyridine may exhibit unique biological activities, making it of interest in medicinal chemistry. Proper handling and storage are essential due to its potential toxicity and environmental impact.
Formula:C5HBrF3N
InChI:InChI=1S/C5HBrF3N/c6-2-1-3(7)10-5(9)4(2)8/h1H
InChI key:InChIKey=YNKPDGWBIQAKSY-UHFFFAOYSA-N
SMILES:FC=1C(Br)=CC(F)=NC1F
Synonyms:
  • Pyridine, 4-bromo-2,3,6-trifluoro-
  • 4-Bromo-2,3,6-trifluoropyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.