CAS 849938-01-8

(βR)-β-Amino-3,4-dichlorobenzenepropanol

Description:

(βR)-β-Amino-3,4-dichlorobenzenepropanol, with the CAS number 849938-01-8, is a chemical compound characterized by its structural features, which include a propanol backbone substituted with an amino group and dichlorobenzene moiety. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group and the ability to participate in hydrogen bonding. The presence of the dichlorobenzene ring introduces significant hydrophobic characteristics, which can influence its reactivity and interaction with biological systems. The stereochemistry indicated by the (βR) designation suggests specific spatial arrangements that may affect its biological activity and pharmacological properties. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific receptors or pathways. Additionally, the dichlorobenzene substituents may impart unique electronic properties, making this compound of interest in various chemical research fields, including medicinal chemistry and materials science.

Formula: C₉H₁₁Cl₂NO

InChI: InChI=1S/C9H11Cl2NO/c10-8-2-1-6(4-9(8)11)3-7(12)5-13/h1-2,4,7,13H,3,5,12H2/t7-/m1/s1

InChI key: InChIKey=SDQHHIMPZYXBMS-SSDOTTSWSA-N

SMILES: C([C@H](CO)N)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• D-3,4-Dichlorophenylalaninol
• (βR)-β-Amino-3,4-dichlorobenzenepropanol
• (2r)-2-Amino-3-(3,4-dichlorophenyl)propan-1-ol
• Benzenepropanol, β-amino-3,4-dichloro-, (βR)-

(R)-2-Amino-3-(3,4-dichlorophenyl)propan-1-ol

Controlled Product

CAS: 849938-01-8

Formula: C₉H₁₁Cl₂NO

Color and Shape: Neat

Molecular weight: 220.1

Ref: TR-A604185