CAS 849939-13-5

3,3'-bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-binaphthalene-2,2'-diol

Description:

3,3'-bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-binaphthalene-2,2'-diol, with the CAS number 849939-13-5, is a complex organic compound characterized by its unique structural features and functional groups. This substance contains a binaphthalene core, which is a fused aromatic system that contributes to its stability and potential optical properties. The presence of multiple trifluoromethyl groups enhances its electron-withdrawing characteristics, influencing its reactivity and solubility in various solvents. The hydroxyl groups (-OH) in the structure suggest potential for hydrogen bonding, which may affect its interactions in biological systems or materials science applications. Additionally, the compound's high degree of fluorination typically imparts hydrophobicity and thermal stability, making it suitable for specialized applications in organic electronics, photonics, or as a building block in the synthesis of more complex molecules. Overall, this compound's unique combination of structural elements positions it as a noteworthy candidate for research in advanced materials and chemical synthesis.

Formula: C₃₆H₁₈F₁₂O₂

InChI: InChI=1/C36H18F12O2/c37-33(38,39)21-9-19(10-22(15-21)34(40,41)42)27-13-17-5-1-3-7-25(17)29(31(27)49)30-26-8-4-2-6-18(26)14-28(32(30)50)20-11-23(35(43,44)45)16-24(12-20)36(46,47)48/h1-16,49-50H

SMILES: c1ccc2c(c1)cc(c1cc(cc(c1)C(F)(F)F)C(F)(F)F)c(c2c1c2ccccc2cc(c2cc(cc(c2)C(F)(F)F)C(F)(F)F)c1O)O

(S)-3,3’-Bis[3,5-bis(trifluoromethyl)phenyl]-[1,1’-binaphthalene]-2,2’-diol

CAS: 849939-13-5

Formula: C₃₆H₁₈F₁₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 710.5078

Ref: IN-DA003CDV

(S)-3,3'-Bis(3,5-bis(trifluoromethyl)phenyl)-1,1'-bi-2-napthol

CAS: 849939-13-5

(S)-3,3'-Bis(3,5-bis(trifluoromethyl)phenyl)-1,1'-bi-2-napthol

Purity: 97%,99%ee

Molecular weight: 710.51g/mol

Ref: 54-PC440001