CymitQuimica logo

CAS 849939-13-5

:

3,3'-bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-binaphthalene-2,2'-diol

Description:
3,3'-bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-binaphthalene-2,2'-diol, with the CAS number 849939-13-5, is a complex organic compound characterized by its unique structural features and functional groups. This substance contains a binaphthalene core, which is a fused aromatic system that contributes to its stability and potential optical properties. The presence of multiple trifluoromethyl groups enhances its electron-withdrawing characteristics, influencing its reactivity and solubility in various solvents. The hydroxyl groups (-OH) in the structure suggest potential for hydrogen bonding, which may affect its interactions in biological systems or materials science applications. Additionally, the compound's high degree of fluorination typically imparts hydrophobicity and thermal stability, making it suitable for specialized applications in organic electronics, photonics, or as a building block in the synthesis of more complex molecules. Overall, this compound's unique combination of structural elements positions it as a noteworthy candidate for research in advanced materials and chemical synthesis.
Formula:C36H18F12O2
InChI:InChI=1/C36H18F12O2/c37-33(38,39)21-9-19(10-22(15-21)34(40,41)42)27-13-17-5-1-3-7-25(17)29(31(27)49)30-26-8-4-2-6-18(26)14-28(32(30)50)20-11-23(35(43,44)45)16-24(12-20)36(46,47)48/h1-16,49-50H
InChI key:PGXMYJSTCAQJBY-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)cc(c1cc(cc(c1)C(F)(F)F)C(F)(F)F)c(c2c1c2ccccc2cc(c2cc(cc(c2)C(F)(F)F)C(F)(F)F)c1O)O
Found 4 products.