CymitQuimica logo

CAS 84994-31-0

:

1-Amino-1,2-dihydro-5H-tetrazole-5-thione

Description:
1-Amino-1,2-dihydro-5H-tetrazole-5-thione, with the CAS number 84994-31-0, is a heterocyclic compound characterized by its tetrazole ring structure, which contains four nitrogen atoms and one carbon atom. This compound features an amino group and a thione functional group, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. It is typically a white to off-white solid and is soluble in polar solvents. The presence of the thione group imparts unique chemical properties, such as the ability to participate in nucleophilic reactions. Additionally, the compound may exhibit biological activity, making it of interest for research in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-amino-1,2-dihydro-5H-tetrazole-5-thione is a versatile compound with significant implications in chemical synthesis and potential therapeutic applications.
Formula:CH3N5S
InChI:InChI=1S/CH3N5S/c2-6-1(7)3-4-5-6/h2H2,(H,3,5,7)
InChI key:InChIKey=KRINVAVVCSZIDB-UHFFFAOYSA-N
SMILES:S=C1N(N)N=NN1
Synonyms:
  • 1-Amino-1,2-dihydro-5H-tetrazole-5-thione
  • 5H-Tetrazole-5-thione, 1-amino-1,2-dihydro-
  • 1-Amino-5-mercapto-1H-tetrazole
  • 1-Amino-1H-tetrazole-5-thiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.