CAS 84996-93-0
:5-Hydroxypentanoic acid cyclohexylamide
Description:
5-Hydroxypentanoic acid cyclohexylamide, with the CAS number 84996-93-0, is an organic compound characterized by its amide functional group and a hydroxyl group attached to a pentanoic acid backbone. This compound features a cyclohexyl group, which contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, which can affect its reactivity and stability. Typically, amides like this one can participate in various chemical reactions, including hydrolysis and amidation. The compound may also exhibit specific biological activities, making it of interest in pharmaceutical and biochemical research. Its structural features may allow it to interact with various biological targets, potentially leading to applications in drug development or as a biochemical probe. However, detailed studies would be necessary to fully understand its properties, reactivity, and potential applications in various fields.
Formula:C11H21NO2
InChI:InChI=1/C11H21NO2/c13-9-5-4-8-11(14)12-10-6-2-1-3-7-10/h10,13H,1-9H2,(H,12,14)
SMILES:C1CCC(CC1)N=C(CCCCO)O
Synonyms:- N-Cyclohexyl-5-hydroxypentanamide
- pentanamide, N-cyclohexyl-5-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
