CAS 84999-42-8

4-Formyl-1H-pyrazole-3-carbonitrile

Description:

4-Formyl-1H-pyrazole-3-carbonitrile is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a formyl group (-CHO) at the 4-position and a cyano group (-CN) at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a solid and may exhibit properties such as solubility in polar organic solvents. Its functional groups suggest that it can participate in various chemical reactions, including nucleophilic additions and condensation reactions, making it valuable in the synthesis of more complex molecules. Additionally, compounds like 4-Formyl-1H-pyrazole-3-carbonitrile may possess biological activity, which can be explored for pharmaceutical applications. As with many pyrazole derivatives, it may also exhibit interesting electronic properties due to the conjugation within the ring system. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₅H₃N₃O

InChI: InChI=1S/C5H3N3O/c6-1-5-4(3-9)2-7-8-5/h2-3H,(H,7,8)

InChI key: InChIKey=FVPYENZGJJOSES-UHFFFAOYSA-N

SMILES: C(=O)C=1C(C#N)=NNC1

Synonyms:

• 4-Formyl-1H-pyrazole-3-carbonitrile
• 1H-Pyrazole-3-carbonitrile, 4-formyl-