CAS 85-24-5

[2-Hydroxy-4-(octyloxy)phenyl](2-hydroxyphenyl)methanone

Description:

The chemical substance known as [2-Hydroxy-4-(octyloxy)phenyl](2-hydroxyphenyl)methanone, with the CAS number 85-24-5, is a type of organic compound that belongs to the class of phenolic compounds. It features a phenyl ring substituted with hydroxyl groups and an octyloxy chain, which contributes to its hydrophobic characteristics. This compound is typically characterized by its ability to absorb ultraviolet (UV) light, making it useful in applications such as UV filters in cosmetics and plastics. Its molecular structure includes functional groups that can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the presence of the octyloxy group enhances its lipophilicity, allowing it to interact favorably with lipid environments. The compound may exhibit antioxidant properties due to the presence of hydroxyl groups, which can scavenge free radicals. Overall, its unique structural features contribute to its potential applications in various fields, including materials science and biochemistry.

Formula: C₂₁H₂₆O₄

InChI: InChI=1S/C21H26O4/c1-2-3-4-5-6-9-14-25-16-12-13-18(20(23)15-16)21(24)17-10-7-8-11-19(17)22/h7-8,10-13,15,22-23H,2-6,9,14H2,1H3

InChI key: InChIKey=XRCGPZWJUXJKJF-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(O)C=C(OCCCCCCCC)C=C1)C2=C(O)C=CC=C2

Synonyms:

• 2,2′-Dihydroxy-4-(octyloxy)benzophenone
• Methanone, [2-hydroxy-4-(octyloxy)phenyl](2-hydroxyphenyl)-
• Cyasorb UV 314
• [2-Hydroxy-4-(octyloxy)phenyl](2-hydroxyphenyl)methanone
• Benzophenone, 2,2′-dihydroxy-4-(octyloxy)-