CAS 85-33-6
:LACTAROVIOLIN
Description:
Lactaroviolin, with the CAS number 85-33-6, is a naturally occurring compound classified as a phenolic compound. It is primarily derived from certain fungi, particularly those in the genus Lactarius. This substance is known for its distinctive yellow to orange coloration, which is attributed to its chemical structure. Lactaroviolin exhibits antioxidant properties, making it of interest in various fields, including food science and pharmacology. Its potential applications include use as a natural dye and in the development of functional foods due to its bioactive properties. Additionally, lactaroviolin has been studied for its potential health benefits, including anti-inflammatory and antimicrobial effects. However, further research is necessary to fully understand its mechanisms of action and potential therapeutic applications. As with many natural compounds, the specific characteristics, such as solubility and stability, can vary depending on environmental conditions and the presence of other substances.
Formula:C15H14O
InChI:InChI=1/C15H14O/c1-10(2)12-5-4-11(3)14-7-6-13(9-16)15(14)8-12/h4-9H,1H2,2-3H3
Synonyms:- 4-Methyl-7-(1-methylethenyl)-1-azulenecarbaldehyde
- 7-Isopropenyl-4-methyl-1-azulenecarbaldehyde
- LACTAROVIOLIN
- 4-Methyl-7-isopropenylazulene-1-carbaldehyde
- 4-methyl-7-(prop-1-en-2-yl)azulene-1-carbaldehyde
- 7-isopropenyl-4-methylazulene-1-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lactaroviolin
CAS:Lactaroviolin is an aromatic derivative antibiotic that can inhibit the growth of Mycobacterium tuberculosis.Formula:C15H14OColor and Shape:SolidMolecular weight:210.271
