
CAS 850033-74-8
:(R)-1-Amino-2-(benzyloxycarbonylamino)propane hydrochloride
Description:
(R)-1-Amino-2-(benzyloxycarbonylamino)propane hydrochloride, with the CAS number 850033-74-8, is a chiral amino acid derivative characterized by its specific stereochemistry, which is indicated by the (R) configuration. This compound features an amino group, a propyl backbone, and a benzyloxycarbonyl (Z) protecting group, which is commonly used in peptide synthesis to protect the amino group during chemical reactions. The hydrochloride salt form enhances its solubility in water, making it suitable for various biochemical applications. The presence of the benzyloxycarbonyl group also suggests potential use in the synthesis of peptides or other complex organic molecules. As a chiral compound, it may exhibit unique biological activities and interactions, making it of interest in pharmaceutical research and development. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application in laboratory settings.
Formula:C11H16N2O2·ClH
InChI:InChI=1S/C11H16N2O2.ClH/c1-9(7-12)13-11(14)15-8-10-5-3-2-4-6-10;/h2-6,9H,7-8,12H2,1H3,(H,13,14);1H/t9-;/m1./s1
InChI key:InChIKey=XTQGLCRZNBCNJH-SBSPUUFOSA-N
SMILES:C(OC(N[C@@H](CN)C)=O)C1=CC=CC=C1.Cl
Synonyms:- (R)-1-Amino-2-(benzyloxycarbonylamino)propane hydrochloride
- (R)-Benzyl (1-aminopropan-2-yl)carbamate hydrochloride
- Carbamic acid, [(1R)-2-amino-1-methylethyl]-, phenylmethyl ester, monohydrochloride
- Carbamic acid, N-[(1R)-2-amino-1-methylethyl]-, phenylmethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.