
CAS 850033-84-0
:(10bR)-9-Ethyl-1,3,4,10b-tetrahydro-7-(trifluoromethyl)pyrazino[2,1-a]isoindol-6(2H)-one
Description:
(10bR)-9-Ethyl-1,3,4,10b-tetrahydro-7-(trifluoromethyl)pyrazino[2,1-a]isoindol-6(2H)-one is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a pyrazino and isoindole moiety. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The compound's tetrahydro configuration suggests it is a saturated derivative, which can affect its reactivity and stability. Additionally, the ethyl substituent contributes to its overall hydrophobic character. This compound may exhibit specific pharmacological properties, potentially acting as a ligand or inhibitor in various biological pathways. Its CAS number, 850033-84-0, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. As with many complex organic molecules, understanding its characteristics requires consideration of its molecular interactions, solubility, and potential toxicity, which are critical for its application in research and development.
Formula:C14H15F3N2O
InChI:InChI=1S/C14H15F3N2O/c1-2-8-5-9-11-7-18-3-4-19(11)13(20)12(9)10(6-8)14(15,16)17/h5-6,11,18H,2-4,7H2,1H3/t11-/m0/s1
InChI key:InChIKey=AZBGLEQDAYJKBP-NSHDSACASA-N
SMILES:C(F)(F)(F)C1=C2C([C@]3(N(C2=O)CCNC3)[H])=CC(CC)=C1
Synonyms:- Pyrazino[2,1-a]isoindol-6(2H)-one, 9-ethyl-1,3,4,10b-tetrahydro-7-(trifluoromethyl)-, (10bR)-
- (10bR)-9-Ethyl-1,3,4,10b-tetrahydro-7-(trifluoromethyl)pyrazino[2,1-a]isoindol-6(2H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ANN33840
CAS:ANN33840: Selective 5-HT2C agonist, 300x vs 5-HT2B, 70x vs 5-HT2A; cuts rat food intake.Formula:C14H15F3N2OColor and Shape:SolidMolecular weight:284.28
