CAS 850074-44-1

Ethyl 6-formylbenzo[b]thiophene-2-carboxylate

Description:

Ethyl 6-formylbenzo[b]thiophene-2-carboxylate is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene core, an aldehyde functional group, and an ester group. This compound typically exhibits a yellow to brown color and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water. Its molecular structure contributes to its potential reactivity, particularly in electrophilic aromatic substitution reactions due to the presence of the electron-withdrawing formyl group. Ethyl 6-formylbenzo[b]thiophene-2-carboxylate may also display interesting optical properties, making it a candidate for applications in organic electronics or as a building block in the synthesis of more complex molecules. Additionally, its derivatives could be explored for biological activity, given the presence of the thiophene ring, which is often associated with various pharmacological properties. As with any chemical substance, proper handling and safety precautions should be observed, particularly in laboratory settings.

Formula: C₁₂H₁₀O₃S

InChI: InChI=1S/C12H10O3S/c1-2-15-12(14)11-6-9-4-3-8(7-13)5-10(9)16-11/h3-7H,2H2,1H3

InChI key: InChIKey=XVRFYXPPJJGDJO-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC=2C(C1)=CC=C(C=O)C2

Synonyms:

• Benzo[b]thiophene-2-carboxylic acid, 6-formyl-, ethyl ester
• Ethyl 6-formylbenzo[b]thiophene-2-carboxylate
• 6-Formylbenzo[b]thiophene-2-carboxylic acid ethyl ester