
CAS 850090-12-9
:3,6,9,12,15-Pentaoxaoctadecan-18-oic acid, 1,1′-[(2,5-diiodo-1,4-phenylene)bis(oxy)]bis-
Description:
3,6,9,12,15-Pentaoxaoctadecan-18-oic acid, 1,1′-[(2,5-diiodo-1,4-phenylene)bis(oxy)]bis- is a complex organic compound characterized by its long-chain structure, which includes multiple ether linkages and a carboxylic acid functional group. The presence of five ether groups contributes to its hydrophilicity, while the long carbon chain imparts lipophilic properties, making it amphiphilic. The compound also features a bis(phenylene) moiety with iodine substitutions, which can enhance its electronic properties and potentially increase its reactivity. This structure suggests potential applications in fields such as materials science, particularly in the development of surfactants, emulsifiers, or drug delivery systems. The iodine atoms may also impart unique biological activities or enhance imaging capabilities in biomedical applications. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity associated with iodine and the overall complexity of the molecule.
Formula:C32H52I2O16
InChI:InChI=1S/C32H52I2O16/c33-27-26-30(50-24-22-48-20-18-46-16-14-44-12-10-42-8-6-40-4-2-32(37)38)28(34)25-29(27)49-23-21-47-19-17-45-15-13-43-11-9-41-7-5-39-3-1-31(35)36/h25-26H,1-24H2,(H,35,36)(H,37,38)
InChI key:InChIKey=UELGJRROCPNANI-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOCCC(O)=O)C1=C(I)C=C(OCCOCCOCCOCCOCCOCCC(O)=O)C(I)=C1
Synonyms:- 3,6,9,12,15-Pentaoxaoctadecan-18-oic acid, 1,1′-[(2,5-diiodo-1,4-phenylene)bis(oxy)]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,6,9,12,15-Pentaoxaoctadecan-18-oic acid, 1,1′-[(2,5-diiodo-1,4-phenylene)bis(oxy)]bis-
CAS:Formula:C32H52I2O16Molecular weight:946.5546
