CAS 850142-72-2

6-Bromo-2-fluoropyridin-3-ol

Description:

6-Bromo-2-fluoropyridin-3-ol is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom at the 6-position and a fluorine atom at the 2-position, along with a hydroxyl group (-OH) at the 3-position. This compound typically exhibits properties associated with both halogenated and hydroxylated aromatic compounds, such as increased reactivity and potential for hydrogen bonding due to the hydroxyl group. The presence of bromine and fluorine introduces significant electronegativity, which can influence the compound's polarity and solubility in various solvents. Additionally, the structural features of 6-Bromo-2-fluoropyridin-3-ol may confer biological activity, making it of interest in medicinal chemistry and drug development. Its CAS number, 850142-72-2, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, this compound's unique combination of substituents contributes to its potential utility in synthetic and applied chemistry.

Formula: C₅H₃BrFNO

InChI: InChI=1/C5H3BrFNO/c6-4-2-1-3(9)5(7)8-4/h1-2,9H

SMILES: c1cc(Br)nc(c1O)F

Synonyms:

• 2-Fluoro-3-hydroxy-6-bromopyridine
• 3-Pyridinol, 6-Bromo-2-Fluoro-
• 6-bromo-2-fluoropyridin-3-ol

6-Bromo-2-fluoropyridin-3-ol

CAS: 850142-72-2

Formula: C₅H₃BrFNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.9858

Ref: IN-DA004TE9

6-Bromo-2-fluoropyridin-3-ol

CAS: 850142-72-2

6-Bromo-2-fluoropyridin-3-ol

Purity: 95%

Molecular weight: 191.99g/mol

Ref: 54-PC910235

6-Bromo-2-fluoropyridin-3-ol

CAS: 850142-72-2

Formula: C₅H₃BrFNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.987

Ref: 10-F227809

6-Bromo-2-fluoropyridin-3-ol

Controlled Product

CAS: 850142-72-2

Applications 6-Bromo-2-fluoropyridin-3-ol (cas# 850142-72-2) is a useful research chemical.

Formula: C₅H₃BrFNO

Color and Shape: Neat

Molecular weight: 191.986

Ref: TR-B961663