CymitQuimica logo

CAS 850146-83-7

:

2-hydroxy-5-iodo-4-methylbenzoic acid

Description:
2-Hydroxy-5-iodo-4-methylbenzoic acid, with the CAS number 850146-83-7, is an aromatic carboxylic acid characterized by the presence of a hydroxyl group, an iodine atom, and a methyl group on a benzoic acid framework. This compound features a hydroxyl (-OH) group at the ortho position relative to the carboxylic acid group, which can influence its solubility and reactivity. The iodine substituent at the meta position and the methyl group at the para position contribute to its unique chemical properties, including potential applications in pharmaceuticals and organic synthesis. The presence of the iodine atom may enhance the compound's reactivity in nucleophilic substitution reactions. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting its physical properties such as melting point and solubility in polar solvents. Overall, this compound's structure suggests it may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and material science.
Formula:C8H7IO3
InChI:InChI=1/C8H7IO3/c1-4-2-7(10)5(8(11)12)3-6(4)9/h2-3,10H,1H3,(H,11,12)
SMILES:Cc1cc(c(cc1I)C(=O)O)O
Synonyms:
  • Benzoic Acid, 2-Hydroxy-5-Iodo-4-Methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.