CAS 850161-82-9
:4-iodo-N-methylphenylalanine
Description:
4-Iodo-N-methylphenylalanine is an amino acid derivative characterized by the presence of an iodine atom at the para position of the phenyl ring, along with a methyl group attached to the nitrogen of the amino group. This compound is a modified form of phenylalanine, which is one of the essential amino acids. The introduction of the iodine atom can influence the compound's biochemical properties, such as its solubility, reactivity, and interaction with biological systems. Typically, such modifications can enhance the compound's stability or alter its pharmacological profile, making it of interest in medicinal chemistry and drug design. The presence of the N-methyl group can also affect the steric and electronic properties of the molecule, potentially influencing its binding affinity to various biological targets. As with many halogenated compounds, 4-iodo-N-methylphenylalanine may exhibit unique properties that could be exploited in research and therapeutic applications, particularly in the fields of biochemistry and pharmacology.
Formula:C10H12INO2
InChI:InChI=1/C10H12INO2/c1-12-9(10(13)14)6-7-2-4-8(11)5-3-7/h2-5,9,12H,6H2,1H3,(H,13,14)
Synonyms:- 3-(4-Iodo-phenyl)-2-methylamino-propionic acid
- L-phenylalanine, 4-iodo-N-methyl-
- 4-iodo-N-methyl-L-phenylalanine
- 4-Iodo-N-methyl-D-phenylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.