
CAS 85022-69-1
:Cinchonain Ib
Description:
Cinchonain Ib is a natural alkaloid derived from the bark of the Cinchona tree, which is known for its medicinal properties, particularly in the treatment of malaria. This compound is characterized by its complex molecular structure, which includes multiple chiral centers, contributing to its stereochemical diversity. Cinchonain Ib exhibits a range of biological activities, including antimalarial, analgesic, and anti-inflammatory effects, making it of interest in pharmaceutical research. Its mechanism of action is thought to involve interference with the heme detoxification process in the malaria parasite. Additionally, Cinchonain Ib has been studied for its potential use in various therapeutic applications beyond malaria, including its effects on the central nervous system. The compound is typically isolated through extraction and purification processes from natural sources, and its properties can be influenced by factors such as the extraction method and the specific plant variety. Overall, Cinchonain Ib represents a significant compound in the field of natural products and medicinal chemistry.
Formula:C24H20O9
InChI:InChI=1S/C24H20O9/c25-14-3-1-10(5-17(14)28)12-8-21(31)32-20-9-16(27)13-7-19(30)23(33-24(13)22(12)20)11-2-4-15(26)18(29)6-11/h1-6,9,12,19,23,25-30H,7-8H2/t12-,19+,23+/m0/s1
InChI key:InChIKey=LKCOZWLUAKSRQM-IBUUURQNSA-N
SMILES:OC=1C2=C(C=3[C@@H](CC(=O)OC3C1)C4=CC(O)=C(O)C=C4)O[C@@H]([C@H](O)C2)C5=CC(O)=C(O)C=C5
Synonyms:- 2H,8H-Benzo[1,2-b:3,4-b′]dipyran-8-one, 2,10-bis(3,4-dihydroxyphenyl)-3,4,9,10-tetrahydro-3,5-dihydroxy-, [2R-(2α,3α,10β)]-
- Cinchonain Ib
- 2H,8H-Benzo[1,2-b:3,4-b′]dipyran-8-one, 2,10-bis(3,4-dihydroxyphenyl)-3,4,9,10-tetrahydro-3,5-dihydroxy-, (2R,3R,10S)-
- (2R,3R,10S)-2,10-Bis(3,4-dihydroxyphenyl)-3,4,9,10-tetrahydro-3,5-dihydroxy-2H,8H-benzo[1,2-b:3,4-b′]dipyran-8-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2H,8H-Benzo[1,2-b:3,4-b′]dipyran-8-one, 2,10-bis(3,4-dihydroxyphenyl)-3,4,9,10-tetrahydro-3,5-dihydroxy-, (2R,3R,10S)-
CAS:Formula:C24H20O9Purity:97.5%Molecular weight:452.4102Cinchonain Ib
CAS:<p>Cinchonain Ib is isolated from Eriobotrya japonica leaves.</p>Formula:C24H20O9Purity:98%Color and Shape:SolidMolecular weight:452.41Cinchonain ib
CAS:Oxygen-heterocyclic compoundFormula:C24H20O9Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:452.41Cinchonain IB
CAS:Cinchonain IB is a complex natural product, which is derived from the bark of the Cinchona tree. This tree has historically been significant due to its medicinal properties, particularly in the treatment of malaria. The compound belongs to the class of chemical substances known as flavonoid dimers, specifically sourced from Cinchona species.Formula:C24H20O9Purity:Min. 95%Molecular weight:452.4 g/mol



