CAS 850231-86-6
:diethyl [2-(1H-indol-3-yl)-2-oxoethyl]phosphonate
Description:
Diethyl [2-(1H-indol-3-yl)-2-oxoethyl]phosphonate is a chemical compound characterized by its phosphonate functional group, which is known for its applications in medicinal chemistry and as a potential bioactive agent. The structure features an indole moiety, contributing to its aromatic properties and potential biological activity. The presence of the diethyl phosphonate group suggests that it may exhibit properties typical of phosphonates, such as being a good leaving group in chemical reactions and potential interactions with biological systems. This compound may be of interest in the development of pharmaceuticals, particularly in the context of targeting specific biological pathways or mechanisms. Additionally, its unique structure may allow for various synthetic modifications, enhancing its utility in research and development. As with many phosphonates, it may also exhibit stability under a range of conditions, making it suitable for various applications in organic synthesis and drug design. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C14H18NO4P
InChI:InChI=1/C14H18NO4P/c1-3-18-20(17,19-4-2)10-14(16)12-9-15-13-8-6-5-7-11(12)13/h5-9,15H,3-4,10H2,1-2H3
SMILES:CCOP(=O)(CC(=O)c1c[nH]c2ccccc12)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.