CAS 850264-01-6
:N-[(E,1S)-2-hydroxy-1-(hydroxymethyl)non-3-enyl]butanamide
Description:
N-[(E,1S)-2-hydroxy-1-(hydroxymethyl)non-3-enyl]butanamide, with the CAS number 850264-01-6, is a chemical compound characterized by its amide functional group and a complex hydrocarbon chain. This substance features a non-linear carbon skeleton, which includes a hydroxymethyl group and a hydroxyl group, contributing to its potential reactivity and solubility in various solvents. The presence of the double bond in the non-3-enyl portion indicates that it may exhibit cis-trans isomerism, influencing its physical and chemical properties. The compound's structure suggests it may participate in hydrogen bonding due to the hydroxyl and amide functionalities, which can affect its boiling point and solubility in polar solvents. Additionally, the stereochemistry indicated by the (E,1S) notation implies specific spatial arrangements that could be significant in biological interactions or reactivity. Overall, this compound's unique structural features may render it of interest in fields such as medicinal chemistry or materials science, where its properties can be harnessed for various applications.
Formula:C14H27NO3
InChI:InChI=1/C14H27NO3/c1-3-5-6-7-8-10-13(17)12(11-16)15-14(18)9-4-2/h8,10,12-13,16-17H,3-7,9,11H2,1-2H3,(H,15,18)/b10-8+/t12-,13?/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.