
CAS 850348-70-8
:2-[(2-Bromophenoxy)methyl]-1,3-dioxolane
Description:
2-[(2-Bromophenoxy)methyl]-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a bromophenoxy group. The presence of the dioxolane moiety contributes to its potential as a solvent or intermediate in organic synthesis. The bromophenoxy substituent enhances its reactivity and may impart specific biological or chemical properties, making it of interest in medicinal chemistry and materials science. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle it with care, as the bromine atom can introduce toxicity and environmental concerns. The compound's solubility, stability, and reactivity can vary based on the solvent and conditions used in experiments. As with many organic compounds, proper safety protocols should be followed when working with it, including the use of personal protective equipment and appropriate waste disposal methods. Overall, 2-[(2-Bromophenoxy)methyl]-1,3-dioxolane is a versatile compound with potential applications in various fields of chemistry.
Formula:C10H11BrO3
InChI:InChI=1S/C10H11BrO3/c11-8-3-1-2-4-9(8)14-7-10-12-5-6-13-10/h1-4,10H,5-7H2
InChI key:InChIKey=MEWOEYWQZDBKEF-UHFFFAOYSA-N
SMILES:O(CC1OCCO1)C2=C(Br)C=CC=C2
Synonyms:- 2-[(2-Bromophenoxy)methyl]-1,3-dioxolane
- 1,3-Dioxolane, 2-[(2-bromophenoxy)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.