
CAS 850348-74-2
:2-[(3-Methylphenoxy)methyl]-1,3-dioxolane
Description:
2-[(3-Methylphenoxy)methyl]-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a phenoxy group. The presence of the 3-methylphenyl moiety contributes to its aromatic properties, while the dioxolane ring provides a five-membered cyclic ether structure that can influence its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic ether functionalities. It may participate in various chemical reactions typical of ethers and aromatic compounds, such as nucleophilic substitutions or electrophilic aromatic substitutions. The compound's potential applications could span across fields such as pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific uses would depend on further research into its biological activity and chemical behavior. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c1-9-3-2-4-10(7-9)14-8-11-12-5-6-13-11/h2-4,7,11H,5-6,8H2,1H3
InChI key:InChIKey=OZPOXDKIDDUPFI-UHFFFAOYSA-N
SMILES:O(CC1OCCO1)C2=CC(C)=CC=C2
Synonyms:- 1,3-Dioxolane, 2-[(3-methylphenoxy)methyl]-
- 2-[(3-Methylphenoxy)methyl]-1,3-dioxolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.