CAS 850348-84-4

3-(1,3-dioxolan-2-ylmethoxy)benzaldehyde

Description:

3-(1,3-Dioxolan-2-ylmethoxy)benzaldehyde is an organic compound characterized by its aromatic aldehyde structure, which features a benzaldehyde moiety linked to a dioxolane ring through a methoxy group. The presence of the dioxolane ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound typically exhibits a moderate polarity due to the combination of the hydrophobic benzene ring and the more polar dioxolane and aldehyde functional groups. It may participate in various chemical reactions, such as nucleophilic additions or condensation reactions, owing to the electrophilic nature of the aldehyde group. Additionally, the compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that can facilitate further functionalization. Safety data and handling precautions should be considered, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.

Formula: C₁₁H₁₂O₄

InChI: InChI=1/C11H12O4/c12-7-9-2-1-3-10(6-9)15-8-11-13-4-5-14-11/h1-3,6-7,11H,4-5,8H2

SMILES: c1cc(cc(c1)OCC1OCCO1)C=O

Synonyms:

• Benzaldehyde, 3-(1,3-Dioxolan-2-Ylmethoxy)-
• 3-(1,3-Dioxolan-2-ylmethoxy)benzaldehyde