CAS 850349-02-9

8-bromoimidazo[1,2-a]pyridine

Description:

8-Bromoimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, with a bromine substituent at the 8-position of the imidazole ring. This compound typically exhibits a pale yellow to off-white solid appearance and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the bromine atom enhances its reactivity and can influence its interaction with biological targets. It is soluble in organic solvents, which facilitates its use in various chemical reactions and applications. The compound's structure allows for potential interactions with enzymes and receptors, contributing to its pharmacological properties. Additionally, 8-bromoimidazo[1,2-a]pyridine may serve as a building block in the synthesis of more complex molecules, highlighting its utility in organic synthesis. As with many chemical substances, proper handling and safety precautions are essential due to its potential toxicity and reactivity.

Formula: C₇H₅BrN₂

InChI: InChI=1/C7H5BrN2/c8-6-2-1-4-10-5-3-9-7(6)10/h1-5H

SMILES: c1cc(c2nccn2c1)Br

Synonyms:

• imidazo[1,2-a]pyridine, 8-bromo-8-Bromo-Imidazo[1,2-A]Pyridine

8-Bromoimidazo[1,2-a]pyridine

CAS: 850349-02-9

Formula: C₇H₅BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 197.0320

Ref: IN-DA008GZC

8-Bromoimidazo[1,2-a]pyridine

CAS: 850349-02-9

8-Bromoimidazo[1,2-a]pyridine

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 197.03g/mol

Ref: 54-OR30604

8-Bromoimidazo[1,2-a]pyridine

CAS: 850349-02-9

Formula: C₇H₅BrN₂

Purity: 97%

Color and Shape: Solid, Crystalline Powder or Powder

Molecular weight: 197.035

Ref: 10-F077032

8-Bromo-imidazo[1,2-a]pyridine

CAS: 850349-02-9

8-Bromo-imidazo[1,2-a]pyridine is a neutralizing agent that can be used in the synthesis of succinimide. It reacts with chloroacetaldehyde to yield the imidate ester. This reaction is catalyzed by alkali and requires filtration to remove the bromine and any other impurities. The reaction generates heat, so it must be performed in a well-ventilated area.

Formula: C₇H₅BrN₂

Purity: Min. 95%

Molecular weight: 197.03 g/mol

Ref: 3D-FB54448