CAS 850349-18-7
:ethyl [(2-bromopyridin-3-yl)oxy]acetate
Description:
Ethyl [(2-bromopyridin-3-yl)oxy]acetate is an organic compound characterized by its ester functional group, which is derived from acetic acid and ethyl alcohol. The presence of the 2-bromopyridine moiety indicates that the compound contains a bromine atom attached to a pyridine ring, specifically at the 2-position, which can influence its reactivity and biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic characteristics. Ethyl [(2-bromopyridin-3-yl)oxy]acetate may be used in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals, owing to the presence of the pyridine ring, which is often associated with biological activity. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C9H10BrNO3
InChI:InChI=1/C9H10BrNO3/c1-2-13-8(12)6-14-7-4-3-5-11-9(7)10/h3-5H,2,6H2,1H3
SMILES:CCOC(=O)COc1cccnc1Br
Synonyms:- Acetic Acid, 2-[(2-Bromo-3-Pyridinyl)Oxy]-, Ethyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
