CAS 850349-44-9

6,7-Dihydro-4H-pyrano[4,3-d]thiazole-2-acetonitrile

Description:

6,7-Dihydro-4H-pyrano[4,3-d]thiazole-2-acetonitrile is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyran and thiazole ring. This compound features a nitrile functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the thiazole ring often imparts biological activity, making such compounds of interest in drug discovery. The molecular structure typically exhibits moderate polarity due to the presence of the nitrile and heteroatoms, influencing its solubility and interaction with biological targets. Additionally, the compound may exhibit various physical properties such as melting point and boiling point, which are essential for understanding its stability and behavior under different conditions. Its CAS number, 850349-44-9, allows for precise identification in chemical databases, facilitating research and development in fields such as pharmaceuticals and agrochemicals. Overall, 6,7-Dihydro-4H-pyrano[4,3-d]thiazole-2-acetonitrile represents a versatile scaffold for further chemical modifications and applications.

Formula: C₈H₈N₂OS

InChI: InChI=1S/C8H8N2OS/c9-3-1-8-10-6-2-4-11-5-7(6)12-8/h1-2,4-5H2

InChI key: InChIKey=VAJLRWYUKKSNHZ-UHFFFAOYSA-N

SMILES: C(C#N)C1=NC2=C(S1)COCC2

Synonyms:

• (6,7-Dihydro-4H-Pyrano[4,3-D]Thiazol-2-Yl)-Acetonitrile
• 2-(6,7-Dihydro-4H-Pyrano[4,3-D]Thiazol-2-Yl)Acetonitrile
• 6,7-Dihydro-4H-pyrano[4,3-d]thiazole-2-acetonitrile
• 4H-Pyrano[4,3-d]thiazole-2-acetonitrile, 6,7-dihydro-