CymitQuimica logo

CAS 850349-94-9

:

3-Bromo-5-chloro-N-(2-methoxyethyl)-2-pyridinamine

Description:
3-Bromo-5-chloro-N-(2-methoxyethyl)-2-pyridinamine is a chemical compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with both bromine and chlorine atoms, as well as an amine functional group. The presence of the methoxyethyl group enhances its solubility and may influence its biological activity. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of potential drug candidates due to its unique structural features. The halogen substituents (bromo and chloro) can significantly affect the compound's reactivity and interaction with biological targets. Additionally, the amine group can participate in hydrogen bonding, which is crucial for its potential interactions in biological systems. Overall, 3-Bromo-5-chloro-N-(2-methoxyethyl)-2-pyridinamine exhibits properties that make it of interest in medicinal chemistry, particularly in the context of developing new therapeutic agents.
Formula:C8H10BrClN2O
InChI:InChI=1S/C8H10BrClN2O/c1-13-3-2-11-8-7(9)4-6(10)5-12-8/h4-5H,2-3H2,1H3,(H,11,12)
InChI key:InChIKey=DEVOCOKIOCAULV-UHFFFAOYSA-N
SMILES:N(CCOC)C1=C(Br)C=C(Cl)C=N1
Synonyms:
  • 3-Bromo-5-chloro-N-(2-methoxyethyl)-2-pyridinamine
  • 2-Pyridinamine, 3-bromo-5-chloro-N-(2-methoxyethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.