
CAS 850349-96-1
:5-Bromo-N-hexyl-2-pyridinamine
Description:
5-Bromo-N-hexyl-2-pyridinamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position of the pyridine ring and a hexyl group attached to the nitrogen atom contributes to its unique properties. This compound is likely to exhibit moderate to high lipophilicity due to the hexyl chain, which can influence its solubility in organic solvents and its potential biological activity. The amine functional group can participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. Additionally, the bromine substituent may impart specific electronic effects, influencing the compound's reactivity in nucleophilic substitution reactions. Overall, 5-Bromo-N-hexyl-2-pyridinamine may find applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that can modulate biological activity. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C11H17BrN2
InChI:InChI=1S/C11H17BrN2/c1-2-3-4-5-8-13-11-7-6-10(12)9-14-11/h6-7,9H,2-5,8H2,1H3,(H,13,14)
InChI key:InChIKey=CLBBDEGBRCDYEE-UHFFFAOYSA-N
SMILES:N(CCCCCC)C1=CC=C(Br)C=N1
Synonyms:- 2-Pyridinamine, 5-bromo-N-hexyl-
- 5-Bromo-N-hexyl-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.