CAS 850350-15-1
:4-(1,3-dioxolan-2-ylmethoxy)benzonitrile
Description:
4-(1,3-Dioxolan-2-ylmethoxy)benzonitrile, with the CAS number 850350-15-1, is an organic compound characterized by its unique structural features. It contains a benzonitrile moiety, which is a benzene ring substituted with a nitrile group (-C≡N), contributing to its potential as a building block in organic synthesis and pharmaceuticals. The presence of a 1,3-dioxolane ring indicates that it has a cyclic ether structure, which can enhance its reactivity and solubility in various solvents. This compound may exhibit properties such as moderate polarity due to the nitrile and ether functionalities, influencing its interactions in chemical reactions. Additionally, the dioxolane group can provide stability and may participate in various chemical transformations, making it useful in synthetic organic chemistry. Its specific applications would depend on its reactivity and the functional groups present, which could allow for further derivatization or incorporation into larger molecular frameworks. Overall, this compound represents a versatile structure with potential utility in various chemical contexts.
Formula:C11H11NO3
InChI:InChI=1/C11H11NO3/c12-7-9-1-3-10(4-2-9)15-8-11-13-5-6-14-11/h1-4,11H,5-6,8H2
SMILES:c1cc(ccc1C#N)OCC1OCCO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.