
CAS 850363-66-5
:5-Bromo-4-(phenylmethoxy)-1H-indazole
Description:
5-Bromo-4-(phenylmethoxy)-1H-indazole is a chemical compound characterized by its indazole core, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a phenylmethoxy group at the 4-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the indazole moiety, which is known for various biological activities. The bromine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the phenylmethoxy group may provide lipophilicity, aiding in membrane permeability. As with many synthetic organic compounds, safety and handling precautions should be observed, and its stability under various conditions should be assessed for practical applications.
Formula:C14H11BrN2O
InChI:InChI=1S/C14H11BrN2O/c15-12-6-7-13-11(8-16-17-13)14(12)18-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17)
InChI key:InChIKey=BMLQCJLQVVXXLD-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C3C(=CC=C2Br)NN=C3
Synonyms:- 1H-Indazole, 5-bromo-4-(phenylmethoxy)-
- 5-Bromo-4-(phenylmethoxy)-1H-indazole
- 4-Benzyloxy-5-bromo-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.