CymitQuimica logo

CAS 850363-69-8

:

1H-Indazole, 5-bromo-4-propoxy-

Description:
1H-Indazole, 5-bromo-4-propoxy- is a chemical compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a propoxy group at the 4-position contributes to its unique properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the hydrophobic nature of the propoxy group. The bromine substituent can enhance the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the indazole structure is known for its biological activity, which may include antimicrobial and anti-inflammatory properties. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, 1H-Indazole, 5-bromo-4-propoxy- is of interest in both synthetic organic chemistry and medicinal chemistry research.
Formula:C10H11BrN2O
InChI:InChI=1S/C10H11BrN2O/c1-2-5-14-10-7-6-12-13-9(7)4-3-8(10)11/h3-4,6H,2,5H2,1H3,(H,12,13)
InChI key:InChIKey=KSNXHGQFKYYUBW-UHFFFAOYSA-N
SMILES:O(CCC)C1=C2C(=CC=C1Br)NN=C2
Synonyms:
  • 1H-Indazole, 5-bromo-4-propoxy-
  • 5-Bromo-4-propoxy-1H-indazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.