CymitQuimica logo

CAS 850375-02-9

:

N,4-Dimethyl-2-phenyl-5-thiazolemethanamine

Description:
N,4-Dimethyl-2-phenyl-5-thiazolemethanamine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a dimethyl group at the nitrogen position and a phenyl group attached to the carbon adjacent to the thiazole. The presence of these functional groups contributes to its unique chemical properties, including potential biological activity. It may exhibit characteristics such as moderate solubility in organic solvents and varying stability depending on environmental conditions. The thiazole moiety is often associated with various pharmacological activities, making compounds like this of interest in medicinal chemistry. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. However, specific data regarding its reactivity, toxicity, and detailed applications would require further investigation through experimental studies and literature reviews.
Formula:C12H14N2S
InChI:InChI=1S/C12H14N2S/c1-9-11(8-13-2)15-12(14-9)10-6-4-3-5-7-10/h3-7,13H,8H2,1-2H3
InChI key:InChIKey=GFAGRBRYZWAUSV-UHFFFAOYSA-N
SMILES:C(NC)C=1SC(=NC1C)C2=CC=CC=C2
Synonyms:
  • 5-thiazolemethanamine, N,4-dimethyl-2-phenyl-
  • N,4-Dimethyl-2-phenyl-5-thiazolemethanamine
  • N-methyl-N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.