CAS 850375-10-9
:2-isocyanato-4-methylthiophene
Description:
2-Isocyanato-4-methylthiophene is an organic compound characterized by the presence of both isocyanate and thiophene functional groups. It features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, and an isocyanate group (-N=C=O) attached to the second carbon of the thiophene. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its reactivity, particularly due to the isocyanate functional group, which can participate in various chemical reactions, including nucleophilic addition and polymerization. The presence of the methyl group at the 4-position of the thiophene ring can influence its electronic properties and reactivity. 2-Isocyanato-4-methylthiophene is of interest in materials science and organic synthesis, particularly in the development of polymers and as an intermediate in the synthesis of other chemical compounds. As with many isocyanates, it should be handled with care due to its potential toxicity and irritant properties.
Formula:C6H5NOS
InChI:InChI=1/C6H5NOS/c1-5-2-6(7-4-8)9-3-5/h2-3H,1H3
SMILES:Cc1cc(N=C=O)sc1
Synonyms:- Thiophene, 2-Isocyanato-4-Methyl-
- 2-isocyanato-4-methylthiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.