CAS 85038-45-5
:2-Chloropropionylglycine
Description:
2-Chloropropionylglycine is an organic compound characterized by its structure, which includes a glycine moiety and a chloropropionyl group. It is classified as an amino acid derivative, featuring both an amine and a carboxylic acid functional group. The presence of the chlorine atom in the propionyl group introduces unique reactivity, making it a potential intermediate in various chemical syntheses. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the amino and carboxylic acid groups. Its molecular formula indicates a moderate molecular weight, and it may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data suggests that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-Chloropropionylglycine serves as a valuable compound in organic synthesis and medicinal chemistry, warranting further investigation into its properties and applications.
Formula:C5H8ClNO3
InChI:InChI=1/C5H8ClNO3/c1-3(6)5(10)7-2-4(8)9/h3H,2H2,1H3,(H,7,10)(H,8,9)
SMILES:CC(C(=NCC(=O)O)O)Cl
Synonyms:- glycine, N-(2-chloro-1-oxopropyl)-
- N-(2-Chloropropanoyl)glycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Glycine,N-(2-chloro-1-oxopropyl)-
CAS:Formula:C5H8ClNO3Purity:97%Color and Shape:SolidMolecular weight:165.5749Tiopronin Impurity 1
CAS:Formula:C5H8ClNO3Color and Shape:White To Off-White SolidMolecular weight:165.57N-(2-Chloro-1-oxopropyl)glycine
CAS:Controlled ProductImpurity Tiopronin Impuriy 1
Applications N-(2-Chloro-1-oxopropyl)glycine (Tiopronin Impuriy 1) is an impurity of Tiopronin (T444782), which is used as an antidote against heavy metal poisoning.
References Capasso, F., et al.: Agents Actions, 11, 741 (1981), Amor, B., et al.: Arthritis Rheum., 25, 698 (1982), Ichida, F., et al.: J. Int. Med. Res., 10, 325 (1982),Formula:C5H8ClNO3Color and Shape:NeatMolecular weight:165.572-Chloropropionylglycine
CAS:2-Chloropropionylglycine is an organic chemical compound that is used as a raw material for the production of other chemicals. It is a colorless, odorless solid with a melting point of 131°C. 2-Chloropropionylglycine has high chemical stability and can be used in industrial processes to produce ethyl acetate, sodium carbonate, and carbonates. 2-Chloropropionylglycine can also be used as a precursor for other chemicals such as chlorinated acetic acid and glyoxylic acid.Formula:C5H8ClNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:165.57 g/mol






