
CAS 850411-06-2
:N-(2,2-Dimethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Description:
N-(2,2-Dimethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, with CAS number 850411-06-2, is a chemical compound characterized by its unique structural features that include a benzamide moiety and a boron-containing dioxaborolane group. This compound typically exhibits properties such as moderate solubility in organic solvents, which is influenced by the presence of the dimethoxyethyl group that enhances its polarity. The dioxaborolane unit is known for its reactivity in various chemical transformations, particularly in Suzuki coupling reactions, making this compound potentially useful in organic synthesis and medicinal chemistry. Additionally, the presence of the dimethoxyethyl substituent may contribute to its stability and solubility profile. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which could affect its physical properties and reactivity. Overall, this compound represents a versatile building block in the development of more complex organic molecules.
Formula:C17H26BNO5
InChI:InChI=1S/C17H26BNO5/c1-16(2)17(3,4)24-18(23-16)13-9-7-12(8-10-13)15(20)19-11-14(21-5)22-6/h7-10,14H,11H2,1-6H3,(H,19,20)
InChI key:InChIKey=FQLNWUNLGCBRLM-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(C(NCC(OC)OC)=O)C=C2
Synonyms:- N-(2,2-Dimethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
- Benzamide, N-(2,2-dimethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(2,2-Dimethoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
CAS:Formula:C17H26BNO5Molecular weight:335.2030
