CAS 850429-52-6

4-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]benzenesulfonamide

Description:

4-Bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a sulfonamide functional group, a bromine atom, and a tert-butyl(dimethyl)silyl ether moiety. The presence of the sulfonamide group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The tert-butyl(dimethyl)silyl group enhances the compound's stability and solubility, making it suitable for various synthetic applications. Additionally, the bromine substituent can serve as a site for further chemical modifications, allowing for the synthesis of derivatives with tailored properties. This compound is typically handled with care due to the potential reactivity of its functional groups and the presence of bromine, which can pose environmental and health risks. Overall, its unique structural features make it a valuable compound in organic synthesis and drug development.

Formula: C₁₄H₂₄BrNO₃SSi

InChI: InChI=1/C14H24BrNO3SSi/c1-14(2,3)21(4,5)19-11-10-16-20(17,18)13-8-6-12(15)7-9-13/h6-9,16H,10-11H2,1-5H3

SMILES: CC(C)(C)[Si](C)(C)OCCNS(=O)(=O)c1ccc(cc1)Br

4-Bromo-N-[2-(TBDMSO)ethyl]benzenesulfonamide

CAS: 850429-52-6

Formula: C₁₄H₂₄BrNO₃SSi

Purity: 98%

Color and Shape: Solid

Molecular weight: 394.3998

Ref: IN-DA003L0M

4-Bromo-N-[2-(tert-butyldimethylsilyloxy)ethyl]benzenesulphonamide

CAS: 850429-52-6

4-Bromo-N-[2-(tert-butyldimethylsilyloxy)ethyl]benzenesulphonamide

Purity: 98%

Molecular weight: 394.40g/mol

Ref: 54-OR5709

4-Bromo-N-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]benzenesulfonamide

CAS: 850429-52-6

Purity: 98%

Molecular weight: 394.3999939

Ref: 10-F638333