CAS 850429-59-3

4-bromo-1,2-dimethyl-1H-imidazole

Description:

4-Bromo-1,2-dimethyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of the bromine atom at the 4-position and two methyl groups at the 1 and 2 positions contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. It may display interesting reactivity patterns, including electrophilic substitution and nucleophilic reactions, owing to the electron-withdrawing nature of the bromine substituent. Additionally, the imidazole ring is known for its biological significance, often found in various pharmaceuticals and biologically active molecules. The compound's molecular structure suggests potential applications in medicinal chemistry, agrochemicals, or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula: C₅H₇BrN₂

InChI: InChI=1/C5H7BrN2/c1-4-7-5(6)3-8(4)2/h3H,1-2H3

SMILES: Cc1nc(cn1C)Br

Synonyms:

• 1H-imidazole, 4-bromo-1,2-dimethyl-
• 4-Bromo-1,2-dimethyl-1H-imidazole

4-bromo-1,2-dimethyl-1H-imidazole

CAS: 850429-59-3

Formula: C₅H₇BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 175.0265

Ref: IN-DA0036G2

4-Bromo-1,2-dimethyl-1H-imidazole

CAS: 850429-59-3

4-Bromo-1,2-dimethyl-1H-imidazole

Formula: C₅H₇BrN₂

Purity: 96%

Color and Shape: light brown solid

Molecular weight: 175.03g/mol

Ref: 54-OR1222

4-Bromo-1,2-dimethyl-1H-imidazole

CAS: 850429-59-3

Formula: C₅H₇BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 175.029

Ref: 10-F433429